Macarangioside D | CAS | 819870-23-0 |
| Molecular Weight | 386.44 |
| Formula | C19H30O8 |
| SMILES | O=C1C=C(CO)[C@H](/C=C/[C@@H](O[C@H]2[C@@H]([C@H]([C@@H]([C@@H](CO)O2)O)O)O)C)C(C)(C)C1 |
| Intended Use | For research and further manufacturing use only. |
| Shipping | Room temperature. |
| Catalog Number | Product Name | Order | Quantity |
|---|---|---|---|
| PDP-17173 | 10-O-Methylprotosappanin B | Inquiry |
|
| PDP-16984 | 5-OH-HxMF | Inquiry |
|
| PDP-16474 | Tigloylgomisin P | Inquiry |
|
| PDP-19270 | 1,5-Anhydro-D-mannitol | Inquiry |
|
| PDP-17851 | Bis-(-)-8-demethylmaritidine | Inquiry |
|
| PDP-19554 | α-Calacorene | Inquiry |
|
CD BioSustainable is a well-known professional company in the industry. We provide a wide range of bio-environmental products, including bio-based materials, biomass fuels, green building materials, bio-environmental enzymes, bio-environmental microorganisms, etc. Please feel free to explore.
Our products and services are for research use only and cannot be used for any clinical purposes.
