Macatrichocarpin A | CAS | 1038753-13-7 |
| Molecular Weight | 354.40 |
| Formula | C21H22O5 |
| SMILES | O=C1C2=C(O)C=C(O)C=C2O[C@H](C3=CC(C/C=C(C)/C)=C(OC)C=C3)C1 |
| Intended Use | For research and further manufacturing use only. |
| Shipping | Room temperature. |
| Catalog Number | Product Name | Order | Quantity |
|---|---|---|---|
| PDP-17931 | 19-Hydroxybaccatin III | Inquiry |
|
| PDP-17415 | Rabdoserrin A | Inquiry |
|
| PDP-13772 | Ethyl Gallate | Inquiry |
|
| PDP-16024 | Ajugacumbin B | Inquiry |
|
| PDP-15073 | Xanthohumol D | Inquiry |
|
| PDP-14405 | Gitogenin | Inquiry |
|
CD BioSustainable is a well-known professional company in the industry. We provide a wide range of bio-environmental products, including bio-based materials, biomass fuels, green building materials, bio-environmental enzymes, bio-environmental microorganisms, etc. Please feel free to explore.
Our products and services are for research use only and cannot be used for any clinical purposes.
