Macquarimicin C | CAS No. | 165561-12-6 |
| Molecular Weight | 370.44 |
| Formula | C22H26O5 |
| SMILES | CC(C[C@@H]1[C@]23[C@@](C[C@](OC3=O)([H])CC2=O)([H])C[C@]4([H])[C@@]1([H])[C@]5([H])[C@](C([C@@H](C5)C)=O)([H])C=C4)=O |
| Intended Use | For research use only. |
| Shipping | Room temperature. |
| Catalog Number | Product Name | Order | Quantity |
|---|---|---|---|
| MDP-24132 | Cytochalasin F | Inquiry |
|
| MDP-22428 | Manninotriose (Standard) | Inquiry |
|
| MDP-22831 | Brevianamide Q | Inquiry |
|
| MDP-24209 | Liposidomycin B | Inquiry |
|
| MDP-24100 | 2-Hydroxybutirosin | Inquiry |
|
| MDP-12134 | Adenylosuccinic Acid | Inquiry |
|
CD BioSustainable is a well-known professional company in the industry. We provide a wide range of bio-environmental products, including bio-based materials, biomass fuels, green building materials, bio-environmental enzymes, bio-environmental microorganisms, etc. Please feel free to explore.
Our products and services are for research use only and cannot be used for any clinical purposes.
