Macranthoin G | Synonyms | Methyl 3,5-dicaffeoyl Quinic Acid |
| CAS | 159934-13-1 |
| Molecular Weight | 530.48 |
| Formula | C26H26O12 |
| SMILES | O=C(OC)[C@@](C1)(O)C[C@@H](OC(/C=C/C2=CC(O)=C(O)C=C2)=O)[C@H](O)[C@@H]1OC(/C=C/C3=CC(O)=C(O)C=C3)=O |
| Intended Use | For research and further manufacturing use only. |
| Shipping | Room temperature. |
| Catalog Number | Product Name | Order | Quantity |
|---|---|---|---|
| PDP-18622 | 11-Deoxymogroside IIIE | Inquiry |
|
| PDP-13829 | Picroside I | Inquiry |
|
| PDP-14581 | Regaloside A | Inquiry |
|
| PDP-18278 | Cimiside B | Inquiry |
|
| PDP-19788 | Norisoboldine (Standard) | Inquiry |
|
| PDP-15789 | Sanggenon D | Inquiry |
|
CD BioSustainable is a well-known professional company in the industry. We provide a wide range of bio-environmental products, including bio-based materials, biomass fuels, green building materials, bio-environmental enzymes, bio-environmental microorganisms, etc. Please feel free to explore.
Our products and services are for research use only and cannot be used for any clinical purposes.
