Macranthoside A | CAS | 128730-82-5 |
| Molecular Weight | 913.10 |
| Formula | C47H76O17 |
| SMILES | C[C@@]12C([C@@]3([H])[C@@](CC2)(CCC(C)(C3)C)C(O)=O)=CC[C@@]4([H])[C@]1(CC[C@]5([H])[C@@]4(CC[C@@H]([C@@]5(C)CO)O[C@H]6[C@@H]([C@H]([C@H](CO6)O)O)O[C@H]7[C@@H]([C@@H]([C@H]([C@@H](O7)C)O)O[C@@H]8O[C@@H]([C@H]([C@@H]([C@H]8O)O)O)CO)O)C)C |
| Intended Use | For research and further manufacturing use only. |
| Shipping | Room temperature. |
| Catalog Number | Product Name | Order | Quantity |
|---|---|---|---|
| PDP-18594 | Fructo-oligosaccharide DP10/GF9 | Inquiry |
|
| PDP-14512 | Loureirin B | Inquiry |
|
| PDP-15483 | 3',5'-Dimethoxyacetophenone | Inquiry |
|
| PDP-17121 | (-)-Praeruptorin A | Inquiry |
|
| PDP-16574 | Acetagastrodin | Inquiry |
|
| PDP-14197 | (-)-Maackiain | Inquiry |
|
CD BioSustainable is a well-known professional company in the industry. We provide a wide range of bio-environmental products, including bio-based materials, biomass fuels, green building materials, bio-environmental enzymes, bio-environmental microorganisms, etc. Please feel free to explore.
Our products and services are for research use only and cannot be used for any clinical purposes.
