Magnocurarine | CAS | 6801-40-7 |
| Molecular Weight | 314.40 |
| Formula | C19H24NO3 |
| SMILES | OC1=CC=C(C[C@@H]2C3=CC(O)=C(C=C3CC[N+]2(C)C)OC)C=C1 |
| Intended Use | For research and further manufacturing use only. |
| Shipping | Room temperature. |
| Catalog Number | Product Name | Order | Quantity |
|---|---|---|---|
| PDP-18182 | Massonianoside B | Inquiry |
|
| PDP-14662 | Makisterone A | Inquiry |
|
| PDP-13910 | Rhamnetin | Inquiry |
|
| PDP-20393 | Triptonide (Standard) | Inquiry |
|
| PDP-17121 | (-)-Praeruptorin A | Inquiry |
|
| PDP-14754 | Synephrine Hydrochloride | Inquiry |
|
CD BioSustainable is a well-known professional company in the industry. We provide a wide range of bio-environmental products, including bio-based materials, biomass fuels, green building materials, bio-environmental enzymes, bio-environmental microorganisms, etc. Please feel free to explore.
Our products and services are for research use only and cannot be used for any clinical purposes.