(+)-Magnoflorine Chloride | Synonyms | Magnoflorine Chloride; α-Magnoflorine Chloride; Thalictrine Chloride |
| Appearance | Solid |
| CAS | 6681-18-1 |
| Purity | 99.29% |
| Molecular Weight | 377.86 |
| Formula | C20H24ClNO4 |
| Color | Yellow to brown |
| SMILES | OC1=C(C2=C3O)C([C@]([N+]4(C)C)([H])CC2=CC=C3OC)=C(CC4)C=C1OC.[Cl-] |
| Intended Use | For research and further manufacturing use only. |
| Storage |
4°C, sealed storage, away from moisture and light In solvent: -80°C, 6 months; -20°C, 1 month (sealed storage, away from moisture and light) |
| Shipping | Room temperature. |
| Catalog Number | Product Name | Order | Quantity |
|---|---|---|---|
| PDP-15458 | 4',7-Dimethoxyisoflavone | Inquiry |
|
| PDP-18759 | Isotanshinone II | Inquiry |
|
| PDP-16664 | Plantanone B | Inquiry |
|
| PDP-18804 | Quercetin 3-O-Glc-(1→2)-Rha-7-O-Rha | Inquiry |
|
| PDP-13358 | Oroxin B | Inquiry |
|
| PDP-20496 | Wogonoside (Standard) | Inquiry |
|
CD BioSustainable is a well-known professional company in the industry. We provide a wide range of bio-environmental products, including bio-based materials, biomass fuels, green building materials, bio-environmental enzymes, bio-environmental microorganisms, etc. Please feel free to explore.
Our products and services are for research use only and cannot be used for any clinical purposes.
