Magnoloside B | CAS | 116872-05-0 |
| Molecular Weight | 786.73 |
| Formula | C35H46O20 |
| SMILES | O[C@H]([C@@H](CO[C@H]1[C@H](O)[C@@H](O)[C@H](O)[C@@H](CO)O1)O2)[C@@H](OC(/C=C/C3=CC=C(O)C(O)=C3)=O)[C@@H](O[C@H]4[C@@H]([C@@H]([C@H]([C@H](C)O4)O)O)O)[C@@H]2OCCC5=CC=C(O)C(O)=C5 |
| Intended Use | For research and further manufacturing use only. |
| Shipping | Room temperature. |
| Catalog Number | Product Name | Order | Quantity |
|---|---|---|---|
| PDP-16636 | Folinic Acid (Standard) | Inquiry |
|
| PDP-15485 | Ligustilide | Inquiry |
|
| PDP-13291 | Licochalcone A | Inquiry |
|
| PDP-20113 | Ciwujianoside C4 | Inquiry |
|
| PDP-15208 | N-Methylphenethylamine | Inquiry |
|
| PDP-18288 | Coronalolide | Inquiry |
|
CD BioSustainable is a well-known professional company in the industry. We provide a wide range of bio-environmental products, including bio-based materials, biomass fuels, green building materials, bio-environmental enzymes, bio-environmental microorganisms, etc. Please feel free to explore.
Our products and services are for research use only and cannot be used for any clinical purposes.
