Malvidin-3-galactoside Chloride (Standard) | CAS | 30113-37-2 |
| Molecular Weight | 528.89 |
| Formula | C23H25ClO12 |
| SMILES | COC1=C(O)C(OC)=CC(C2=C(O[C@H]3[C@@H]([C@H]([C@H]([C@@H](CO)O3)O)O)O)C=C4C(C=C(O)C=C4O)=[O+]2)=C1.[Cl-] |
| Intended Use | For research and further manufacturing use only. |
| Catalog Number | Product Name | Order | Quantity |
|---|---|---|---|
| PDP-16784 | Pinostilbene (Standard) | Inquiry |
|
| PDP-15471 | Thaumatin B | Inquiry |
|
| PDP-13097 | Paclitaxel | Inquiry |
|
| PDP-19781 | Isoescin IB (Standard) | Inquiry |
|
| PDP-15664 | Ardisiacrispin B | Inquiry |
|
| PDP-14039 | Monotropein | Inquiry |
|
CD BioSustainable is a well-known professional company in the industry. We provide a wide range of bio-environmental products, including bio-based materials, biomass fuels, green building materials, bio-environmental enzymes, bio-environmental microorganisms, etc. Please feel free to explore.
Our products and services are for research use only and cannot be used for any clinical purposes.
