Malvidin 3,5-diglucoside Chloride | CAS | 16727-30-3 |
| Molecular Weight | 691.03 |
| Formula | C29H35ClO17 |
| SMILES | COC1=C(O)C(OC)=CC(C2=C(O[C@H]3[C@@H]([C@H]([C@@H]([C@@H](CO)O3)O)O)O)C=C4C(C=C(O)C=C4O[C@H]5[C@@H]([C@H]([C@@H]([C@@H](CO)O5)O)O)O)=[O+]2)=C1.[Cl-] |
| Intended Use | For research and further manufacturing use only. |
| Shipping | Room temperature. |
| Catalog Number | Product Name | Order | Quantity |
|---|---|---|---|
| PDP-17066 | Trachelosiaside | Inquiry |
|
| PDP-18355 | epi-Vogeloside | Inquiry |
|
| PDP-17560 | Bupleuroside XIII | Inquiry |
|
| PDP-13792 | Liriopesides B | Inquiry |
|
| PDP-17056 | Chrysin 6-C-arabinoside 8-C-glucoside | Inquiry |
|
| PDP-19177 | Isoboldine | Inquiry |
|
CD BioSustainable is a well-known professional company in the industry. We provide a wide range of bio-environmental products, including bio-based materials, biomass fuels, green building materials, bio-environmental enzymes, bio-environmental microorganisms, etc. Please feel free to explore.
Our products and services are for research use only and cannot be used for any clinical purposes.
