Manassantin B | Synonyms | (-)-Manassantin B |
| Appearance | Solid |
| CAS | 88497-88-5 |
| Purity | 99.29% |
| Molecular Weight | 716.81 |
| Formula | C41H48O11 |
| Color | White to off-white |
| SMILES | C[C@H]1[C@@H](C2=CC(OC)=C(C=C2)O[C@H](C)[C@@H](C3=CC(OC)=C(C=C3)OC)O)O[C@H](C4=CC(OC)=C(C=C4)O[C@H](C)[C@@H](C5=CC=C(OCO6)C6=C5)O)[C@@H]1C |
| Intended Use | For research and further manufacturing use only. |
| Storage |
4°C, sealed storage, away from moisture and light In solvent: -80°C, 6 months; -20°C, 1 month (sealed storage, away from moisture and light) |
| Shipping | Room temperature. |
| Catalog Number | Product Name | Order | Quantity |
|---|---|---|---|
| PDP-16445 | Nonadecane | Inquiry |
|
| PDP-15928 | Strictinin | Inquiry |
|
| PDP-20047 | Tetrandrine (Standard) | Inquiry |
|
| PDP-13998 | Saikosaponin B2 | Inquiry |
|
| PDP-14909 | Verrucosin | Inquiry |
|
| PDP-14143 | 9-Hydroxyoctadecanoic Acid | Inquiry |
|
CD BioSustainable is a well-known professional company in the industry. We provide a wide range of bio-environmental products, including bio-based materials, biomass fuels, green building materials, bio-environmental enzymes, bio-environmental microorganisms, etc. Please feel free to explore.
Our products and services are for research use only and cannot be used for any clinical purposes.
