Maniwamycin B | CAS No. | 122547-71-1 |
| Molecular Weight | 200.28 |
| Formula | C10H20N2O2 |
| SMILES | C[C@H](O)[C@H](C)/N=N(/C=C/CCCC)=O |
| Intended Use | For research use only. |
| Shipping | Room temperature. |
| Catalog Number | Product Name | Order | Quantity |
|---|---|---|---|
| MDP-12676 | Curvulamine A | Inquiry |
|
| MDP-12628 | Thielavin B | Inquiry |
|
| MDP-11227 | Picolinic Acid | Inquiry |
|
| MDP-22227 | Deltamycin A1 | Inquiry |
|
| MDP-12327 | GERI-BP002-A | Inquiry |
|
| MDP-23617 | Depsidomycin | Inquiry |
|
CD BioSustainable is a well-known professional company in the industry. We provide a wide range of bio-environmental products, including bio-based materials, biomass fuels, green building materials, bio-environmental enzymes, bio-environmental microorganisms, etc. Please feel free to explore.
Our products and services are for research use only and cannot be used for any clinical purposes.
