Marcellomycin | CAS No. | 63710-10-1 |
| Molecular Weight | 845.88 |
| Formula | C42H55NO17 |
| SMILES | COC([C@@H]([C@](O)(C1)CC)C(C=C2C(C(C3=C(O)C=CC(O)=C3C2=O)=O)=C4O)=C4[C@H]1O[C@H]5C[C@@H]([C@@H]([C@@H](O5)C)O[C@H]6C[C@@H]([C@@H]([C@@H](O6)C)O[C@H]7C[C@@H]([C@@H]([C@@H](O7)C)O)O)O)N(C)C)=O |
| Intended Use | For research use only. |
| Shipping | Room temperature. |
| Catalog Number | Product Name | Order | Quantity |
|---|---|---|---|
| MDP-12328 | 3'-UMP Disodium | Inquiry |
|
| MDP-11626 | Levoglucosan | Inquiry |
|
| MDP-22837 | Catenulopyrizomicin A | Inquiry |
|
| MDP-11996 | Destruxin B | Inquiry |
|
| MDP-22148 | Berkeleylactone E | Inquiry |
|
| MDP-11566 | Manninotriose | Inquiry |
|
CD BioSustainable is a well-known professional company in the industry. We provide a wide range of bio-environmental products, including bio-based materials, biomass fuels, green building materials, bio-environmental enzymes, bio-environmental microorganisms, etc. Please feel free to explore.
Our products and services are for research use only and cannot be used for any clinical purposes.
