Maridomycin VI | CAS No. | 35775-66-7 |
| Molecular Weight | 801.91 |
| Formula | C39H63NO16 |
| SMILES | CC(CC(C(C(C(C1)OC(C)=O)OC)O[C@H]2[C@@H]([C@H]([C@@H]([C@H](O2)C)O[C@@H]3O[C@H]([C@@H]([C@@](C)(C3)O)OC(C)=O)C)N(C)C)O)CC=O)C(/C=C/C4C(CC(OC1=O)C)O4)O |
| Intended Use | For research use only. |
| Shipping | Room temperature. |
| Catalog Number | Product Name | Order | Quantity |
|---|---|---|---|
| MDP-22847 | Fasciculic Acid A | Inquiry |
|
| MDP-22982 | Hormaomycin | Inquiry |
|
| MDP-23973 | Nebramycin Ⅳ | Inquiry |
|
| MDP-23915 | Cladosporide B | Inquiry |
|
| MDP-12389 | Ganoderenic Acid C | Inquiry |
|
| MDP-12210 | Neosartoricin B | Inquiry |
|
CD BioSustainable is a well-known professional company in the industry. We provide a wide range of bio-environmental products, including bio-based materials, biomass fuels, green building materials, bio-environmental enzymes, bio-environmental microorganisms, etc. Please feel free to explore.
Our products and services are for research use only and cannot be used for any clinical purposes.
