Matlystatin F | CAS No. | 140667-42-1 |
| Molecular Weight | 548.67 |
| Formula | C27H44N6O6 |
| SMILES | O=C(C1N2C=CC(C(C(CC)C)NC(C3N(C(C(CCCCC)CC(NO)=O)=O)NCCC3)=O)=[N+]2CCC1)[O-] |
| Intended Use | For research use only. |
| Shipping | Room temperature. |
| Catalog Number | Product Name | Order | Quantity |
|---|---|---|---|
| MDP-22457 | Thermospermine (Standard) | Inquiry |
|
| MDP-23071 | Carbazomycin C | Inquiry |
|
| MDP-12681 | Guignardone L | Inquiry |
|
| MDP-22869 | Communesin B | Inquiry |
|
| MDP-22305 | Gibberellic Acid (Standard) | Inquiry |
|
| MDP-24106 | 1-Deamino-1-hydroxygentamicin C2 | Inquiry |
|
CD BioSustainable is a well-known professional company in the industry. We provide a wide range of bio-environmental products, including bio-based materials, biomass fuels, green building materials, bio-environmental enzymes, bio-environmental microorganisms, etc. Please feel free to explore.
Our products and services are for research use only and cannot be used for any clinical purposes.
