Melittoside (Standard) | CAS | 19467-03-9 |
| Molecular Weight | 524.47 |
| Formula | C21H32O15 |
| SMILES | O[C@H]1[C@@]([C@](C(CO)=C1)([H])[C@@H]2O[C@]([C@@H]([C@@H](O)[C@@H]3O)O)([H])O[C@@H]3CO)(C=CO2)O[C@]([C@@H]([C@@H](O)[C@@H]4O)O)([H])O[C@@H]4CO |
| Intended Use | For research and further manufacturing use only. |
| Catalog Number | Product Name | Order | Quantity |
|---|---|---|---|
| PDP-13728 | Tubuloside B | Inquiry |
|
| PDP-20050 | Sinomenine Hydrochloride (Standard) | Inquiry |
|
| PDP-14817 | (2S)-6-Prenylnaringenin | Inquiry |
|
| PDP-20321 | Antiviral Agent 64 | Inquiry |
|
| PDP-15112 | Puerarin 6"-O-Xyloside | Inquiry |
|
| PDP-18445 | Hederagonic Acid | Inquiry |
|
CD BioSustainable is a well-known professional company in the industry. We provide a wide range of bio-environmental products, including bio-based materials, biomass fuels, green building materials, bio-environmental enzymes, bio-environmental microorganisms, etc. Please feel free to explore.
Our products and services are for research use only and cannot be used for any clinical purposes.
