Meranzin Hydrate (Standard) | CAS | 5875-49-0 |
| Molecular Weight | 278.30 |
| Formula | C15H18O5 |
| SMILES | CC(C)(O)[C@@H](O)CC1=C(O2)C(C=CC2=O)=CC=C1OC |
| Intended Use | For research and further manufacturing use only. |
| Catalog Number | Product Name | Order | Quantity |
|---|---|---|---|
| PDP-13119 | Topotecan Hydrochloride | Inquiry |
|
| PDP-17738 | Aloveroside A | Inquiry |
|
| PDP-18440 | Hemiphroside B | Inquiry |
|
| PDP-17642 | β-Apopicropodophyllin | Inquiry |
|
| PDP-13651 | Solasodine | Inquiry |
|
| PDP-15786 | Zingibroside R1 | Inquiry |
|
CD BioSustainable is a well-known professional company in the industry. We provide a wide range of bio-environmental products, including bio-based materials, biomass fuels, green building materials, bio-environmental enzymes, bio-environmental microorganisms, etc. Please feel free to explore.
Our products and services are for research use only and cannot be used for any clinical purposes.
