Methyl 3-O-methylgallate | Synonyms | M3OMG |
| Appearance | Solid |
| CAS | 3934-86-9 |
| Purity | 99.73% |
| Molecular Weight | 198.17 |
| Formula | C9H10O5 |
| Color | Off-white to yellow |
| SMILES | COC1=CC(C(OC)=O)=CC(O)=C1O |
| Intended Use | For research and further manufacturing use only. |
| Storage |
Powder: -20°C 3 years; 4°C 2 years In solvent: -80°C 6 months; -20°C 1 month |
| Shipping | Room temperature. |
| Catalog Number | Product Name | Order | Quantity |
|---|---|---|---|
| PDP-18736 | Curculigoside B | Inquiry |
|
| PDP-14233 | Luteolin-3-O-beta-D-glucuronide | Inquiry |
|
| PDP-16357 | Tylophorine | Inquiry |
|
| PDP-14507 | Melamine | Inquiry |
|
| PDP-19095 | 3,4-Seco-4(23),20(29)-lupadiene-3,28-dioic Acid | Inquiry |
|
| PDP-15832 | Geraniol (Standard) | Inquiry |
|
CD BioSustainable is a well-known professional company in the industry. We provide a wide range of bio-environmental products, including bio-based materials, biomass fuels, green building materials, bio-environmental enzymes, bio-environmental microorganisms, etc. Please feel free to explore.
Our products and services are for research use only and cannot be used for any clinical purposes.
