Methylophiopogonone B | Appearance | Solid |
| CAS | 74805-89-3 |
| Purity | 98.65% |
| Molecular Weight | 326.34 |
| Formula | C19H18O5 |
| Color | Off-white to light yellow |
| SMILES | O=C1C(CC2=CC=C(OC)C=C2)=COC3=C(C)C(O)=C(C)C(O)=C13 |
| Intended Use | For research and further manufacturing use only. |
| Storage |
Powder: -20°C 3 years; 4°C 2 years In solvent: -80°C 6 months; -20°C 1 month |
| Shipping | Room temperature. |
| Catalog Number | Product Name | Order | Quantity |
|---|---|---|---|
| PDP-18293 | Coronarin E | Inquiry |
|
| PDP-14033 | Ethoxysanguinarine | Inquiry |
|
| PDP-13023 | Cnidium Monnieri Extract | Inquiry |
|
| PDP-14121 | cis-Isolimonenol | Inquiry |
|
| PDP-15851 | Metacetamol | Inquiry |
|
| PDP-17409 | Bruceantinol A | Inquiry |
|
CD BioSustainable is a well-known professional company in the industry. We provide a wide range of bio-environmental products, including bio-based materials, biomass fuels, green building materials, bio-environmental enzymes, bio-environmental microorganisms, etc. Please feel free to explore.
Our products and services are for research use only and cannot be used for any clinical purposes.
