Militarine | Appearance | Solid |
| CAS | 58139-23-4 |
| Purity | 99.83% |
| Molecular Weight | 726.72 |
| Formula | C34H46O17 |
| Color | White to light yellow |
| SMILES | O[C@H]([C@H]1O)[C@@H](O[C@@H]([C@H]1O)CO)OC(C=C2)=CC=C2COC([C@](CC(C)C)(O)CC(OCC(C=C3)=CC=C3O[C@@H]([C@@H]([C@H]4O)O)O[C@@H]([C@H]4O)CO)=O)=O |
| Intended Use | For research and further manufacturing use only. |
| Storage |
4°C, protect from light In solvent: -80°C, 6 months; -20°C, 1 month (protect from light) |
| Shipping | Room temperature. |
| Catalog Number | Product Name | Order | Quantity |
|---|---|---|---|
| PDP-19266 | Amorfrutin B | Inquiry |
|
| PDP-13383 | N-Hydroxypipecolic Acid | Inquiry |
|
| PDP-15645 | Apigenin-7-diglucuronide | Inquiry |
|
| PDP-19141 | (-)-trans-Myrtanol | Inquiry |
|
| PDP-14207 | Sanggenon C | Inquiry |
|
| PDP-15886 | Arecaidine Hydrochloride | Inquiry |
|
CD BioSustainable is a well-known professional company in the industry. We provide a wide range of bio-environmental products, including bio-based materials, biomass fuels, green building materials, bio-environmental enzymes, bio-environmental microorganisms, etc. Please feel free to explore.
Our products and services are for research use only and cannot be used for any clinical purposes.
