Mimosine | Appearance | Solid |
| CAS | 500-44-7 |
| Purity | 99.92% |
| Molecular Weight | 198.18 |
| Formula | C8H10N2O4 |
| Color | Off-white to light yellow |
| SMILES | OC([C@@H](N)CN1C=CC(C(O)=C1)=O)=O |
| Intended Use | For research and further manufacturing use only. |
| Storage |
4°C, protect from light In solvent: -80°C, 6 months; -20°C, 1 month (protect from light) |
| Shipping | Room temperature. |
| Catalog Number | Product Name | Order | Quantity |
|---|---|---|---|
| PDP-13046 | Pygeum Africanum Extract | Inquiry |
|
| PDP-16085 | Triptonine B | Inquiry |
|
| PDP-16781 | Norepinephrine Hydrochloride (Standard) | Inquiry |
|
| PDP-16738 | meso-Dihydroguaiaretic Acid | Inquiry |
|
| PDP-16853 | Kuguacin R | Inquiry |
|
| PDP-17552 | 6'-O-trans-Feruloylnodakenin | Inquiry |
|
CD BioSustainable is a well-known professional company in the industry. We provide a wide range of bio-environmental products, including bio-based materials, biomass fuels, green building materials, bio-environmental enzymes, bio-environmental microorganisms, etc. Please feel free to explore.
Our products and services are for research use only and cannot be used for any clinical purposes.
