Minumicrolin | Synonyms | Murpanidin; (+)-Murpanidin |
| CAS | 88546-96-7 |
| Molecular Weight | 276.28 |
| Formula | C15H16O5 |
| SMILES | CC([C@H](O)[C@H](C1=C2C(C=CC(O2)=O)=CC=C1OC)O)=C |
| Intended Use | For research and further manufacturing use only. |
| Shipping | Room temperature. |
| Catalog Number | Product Name | Order | Quantity |
|---|---|---|---|
| PDP-14304 | Bruceantinol | Inquiry |
|
| PDP-13906 | Jatrorrhizine Chloride | Inquiry |
|
| PDP-16375 | 7-Prenyloxyaromadendrin | Inquiry |
|
| PDP-17923 | Rauvotetraphylline A | Inquiry |
|
| PDP-17438 | Lanosta-7,9(11),24-trien-3β,15α-dihydrcxy-26-oic Acid | Inquiry |
|
| PDP-19490 | Makisterone B | Inquiry |
|
CD BioSustainable is a well-known professional company in the industry. We provide a wide range of bio-environmental products, including bio-based materials, biomass fuels, green building materials, bio-environmental enzymes, bio-environmental microorganisms, etc. Please feel free to explore.
Our products and services are for research use only and cannot be used for any clinical purposes.
