Moracin M | Appearance | Solid |
| CAS | 56317-21-6 |
| Purity | 98.90% |
| Molecular Weight | 242.23 |
| Formula | C14H10O4 |
| Color | Off-white to light yellow |
| SMILES | OC1=CC(C2=CC3=CC=C(O)C=C3O2)=CC(O)=C1 |
| Intended Use | For research and further manufacturing use only. |
| Storage |
4°C, protect from light In solvent: -80°C, 6 months; -20°C, 1 month (protect from light) |
| Shipping | Room temperature. |
| Catalog Number | Product Name | Order | Quantity |
|---|---|---|---|
| PDP-20185 | Picrinine (Standard) | Inquiry |
|
| PDP-17459 | Ingol 7,8,12-triacetate 3-(4-methoxyphenyl)acetate | Inquiry |
|
| PDP-15984 | (+)-Epicatechin | Inquiry |
|
| PDP-15966 | Yibeissine | Inquiry |
|
| PDP-16531 | Quinine Sulfate Hydrate | Inquiry |
|
| PDP-18647 | Hydroxytanshinone IIA | Inquiry |
|
CD BioSustainable is a well-known professional company in the industry. We provide a wide range of bio-environmental products, including bio-based materials, biomass fuels, green building materials, bio-environmental enzymes, bio-environmental microorganisms, etc. Please feel free to explore.
Our products and services are for research use only and cannot be used for any clinical purposes.
