Morin (Standard) | CAS | 480-16-0 |
| Molecular Weight | 302.24 |
| Formula | C15H10O7 |
| SMILES | O=C1C(O)=C(C2=CC=C(O)C=C2O)OC3=CC(O)=CC(O)=C13 |
| Intended Use | For research and further manufacturing use only. |
| Catalog Number | Product Name | Order | Quantity |
|---|---|---|---|
| PDP-17983 | Fallaxsaponin A | Inquiry |
|
| PDP-19395 | Taxinine B | Inquiry |
|
| PDP-15736 | Astragaloside IV (Standard) | Inquiry |
|
| PDP-20061 | Lycorine Hydrochloride (Standard) | Inquiry |
|
| PDP-18155 | Mucrolidin | Inquiry |
|
| PDP-13598 | Coixol | Inquiry |
|
CD BioSustainable is a well-known professional company in the industry. We provide a wide range of bio-environmental products, including bio-based materials, biomass fuels, green building materials, bio-environmental enzymes, bio-environmental microorganisms, etc. Please feel free to explore.
Our products and services are for research use only and cannot be used for any clinical purposes.
