Mureidomycin B | CAS No. | 114797-05-6 |
| Molecular Weight | 842.92 |
| Formula | C38H50N8O12S |
| SMILES | O=C(O)C(NC(N[C@H](C(N[C@@H](/C(O)=N/C=C1OC(N2CCC(O)=NC2=O)C(O)C/1)C(N(C)C([C@@H](N)CC3=CC=CC(O)=C3)=O)C)=O)CCSC)=O)CC4=CC=CC(O)=C4 |
| Intended Use | For research use only. |
| Shipping | Room temperature. |
| Catalog Number | Product Name | Order | Quantity |
|---|---|---|---|
| MDP-22425 | Terphenyllin (Standard) | Inquiry |
|
| MDP-22058 | Terpendole E | Inquiry |
|
| MDP-22116 | Shermilamine B | Inquiry |
|
| MDP-22685 | Cyclo(L-Pro-L-Val) (Standard) | Inquiry |
|
| MDP-22801 | 2-Heptanol (Standard) | Inquiry |
|
| MDP-22142 | Aldgamycin G | Inquiry |
|
CD BioSustainable is a well-known professional company in the industry. We provide a wide range of bio-environmental products, including bio-based materials, biomass fuels, green building materials, bio-environmental enzymes, bio-environmental microorganisms, etc. Please feel free to explore.
Our products and services are for research use only and cannot be used for any clinical purposes.
