Mussaenoside | CAS | 64421-27-8 |
| Molecular Weight | 390.38 |
| Formula | C17H26O10 |
| SMILES | OC[C@H]([C@@H](O)[C@H](O)[C@H]1O)O[C@@]1([H])O[C@H]2[C@@]3([H])[C@@](CC[C@@]3(O)C)([H])C(C(OC)=O)=CO2 |
| Intended Use | For research and further manufacturing use only. |
| Shipping | Room temperature. |
| Catalog Number | Product Name | Order | Quantity |
|---|---|---|---|
| PDP-19607 | Valeriandoid F | Inquiry |
|
| PDP-17331 | (-)-Toddanol | Inquiry |
|
| PDP-17849 | 3,5-Diprenyl-4-hydroxyacetophenone | Inquiry |
|
| PDP-14393 | Heterophyllin B | Inquiry |
|
| PDP-19800 | Pseudolaric Acid A (Standard) | Inquiry |
|
| PDP-13607 | Polyphyllin II | Inquiry |
|
CD BioSustainable is a well-known professional company in the industry. We provide a wide range of bio-environmental products, including bio-based materials, biomass fuels, green building materials, bio-environmental enzymes, bio-environmental microorganisms, etc. Please feel free to explore.
Our products and services are for research use only and cannot be used for any clinical purposes.
