Myriceric Acid B | CAS | 55497-79-5 |
| Molecular Weight | 634.84 |
| Formula | C39H54O7 |
| SMILES | OC1=C(O)C=CC(/C=C/C(OC[C@]23[C@@]4(C)[C@@](CC=C2[C@@]5([H])[C@](C(O)=O)(CCC(C)(C)C5)CC3)([H])[C@@]6([C@@](C(C)([C@@H](O)CC6)C)([H])CC4)C)=O)=C1 |
| Intended Use | For research and further manufacturing use only. |
| Shipping | Room temperature. |
| Catalog Number | Product Name | Order | Quantity |
|---|---|---|---|
| PDP-14790 | Tetrahydropiperine | Inquiry |
|
| PDP-19543 | Palmatine Chloride (Standard) | Inquiry |
|
| PDP-17908 | Secoisolariciresinol Monoglucoside | Inquiry |
|
| PDP-17104 | DMAA | Inquiry |
|
| PDP-13153 | Picropodophyllin | Inquiry |
|
| PDP-18852 | Quercetin 3-O-sophoroside-7-O-rhamnoside | Inquiry |
|
CD BioSustainable is a well-known professional company in the industry. We provide a wide range of bio-environmental products, including bio-based materials, biomass fuels, green building materials, bio-environmental enzymes, bio-environmental microorganisms, etc. Please feel free to explore.
Our products and services are for research use only and cannot be used for any clinical purposes.
