Myrrhterpenoid O | CAS | 2604667-43-6 |
| Molecular Weight | 260.33 |
| Formula | C16H20O3 |
| SMILES | CO[C@@H]1[C@@]2([H])[C@]([C@H](C1)C)([H])C(C3=C(OC=C3C)C=C2C)=O |
| Intended Use | For research and further manufacturing use only. |
| Shipping | Room temperature. |
| Catalog Number | Product Name | Order | Quantity |
|---|---|---|---|
| PDP-18238 | Isotaxiresinol | Inquiry |
|
| PDP-15842 | Mosloflavone | Inquiry |
|
| PDP-14531 | Sodium Lauryl Sulfoacetate | Inquiry |
|
| PDP-16050 | Sibiricaxanthone B | Inquiry |
|
| PDP-14285 | 4'-Demethylepipodophyllotoxin | Inquiry |
|
| PDP-16755 | 6-Hydroxyluteolin 7-glucoside | Inquiry |
|
CD BioSustainable is a well-known professional company in the industry. We provide a wide range of bio-environmental products, including bio-based materials, biomass fuels, green building materials, bio-environmental enzymes, bio-environmental microorganisms, etc. Please feel free to explore.
Our products and services are for research use only and cannot be used for any clinical purposes.
