N-Demethylansamitocin P-3 | CAS No. | 77353-69-6 |
| Molecular Weight | 621.12 |
| Formula | C31H41ClN2O9 |
| SMILES | C[C@]12[C@@]([C@@H]([C@]3([H])C[C@]([C@@H](/C=C/C=C(CC4=CC(NC(C[C@@H]2OC(C(C)C)=O)=O)=C(C(OC)=C4)Cl)\C)OC)(NC(O3)=O)O)C)([H])O1 |
| Intended Use | For research use only. |
| Shipping | Room temperature. |
| Catalog Number | Product Name | Order | Quantity |
|---|---|---|---|
| MDP-23726 | Minimycin | Inquiry |
|
| MDP-11348 | Tyrosol | Inquiry |
|
| MDP-12623 | Dihydroaltenuene B | Inquiry |
|
| MDP-11361 | L-Dihydroorotic Acid | Inquiry |
|
| MDP-23986 | Oxirapentyn | Inquiry |
|
| MDP-23520 | Auramycin B | Inquiry |
|
CD BioSustainable is a well-known professional company in the industry. We provide a wide range of bio-environmental products, including bio-based materials, biomass fuels, green building materials, bio-environmental enzymes, bio-environmental microorganisms, etc. Please feel free to explore.
Our products and services are for research use only and cannot be used for any clinical purposes.
