N-Methylflindersine | Appearance | Solid |
| CAS | 50333-13-6 |
| Purity | 98.39% |
| Molecular Weight | 241.29 |
| Formula | C15H15NO2 |
| Color | White to off-white |
| SMILES | CN1C2=C(C=CC=C2)C3=C(C=CC(C)(C)O3)C1=O |
| Intended Use | For research and further manufacturing use only. |
| Storage |
-20°C, sealed storage, away from moisture and light In solvent: -80°C, 6 months; -20°C, 1 month (sealed storage, away from moisture and light) |
| Shipping | Room temperature. |
| Catalog Number | Product Name | Order | Quantity |
|---|---|---|---|
| PDP-17154 | Cimiside E | Inquiry |
|
| PDP-16831 | Isocupressic Acid | Inquiry |
|
| PDP-13122 | Beta-Sitosterol (purity>98%) | Inquiry |
|
| PDP-14152 | Licarin B | Inquiry |
|
| PDP-14341 | 4-Hydroxyisoleucine | Inquiry |
|
| PDP-16466 | Puerarin (Standard) | Inquiry |
|
CD BioSustainable is a well-known professional company in the industry. We provide a wide range of bio-environmental products, including bio-based materials, biomass fuels, green building materials, bio-environmental enzymes, bio-environmental microorganisms, etc. Please feel free to explore.
Our products and services are for research use only and cannot be used for any clinical purposes.
