Nagarine | Synonyms | 10-Hydroxy Aconitine |
| CAS | 41849-35-8 |
| Molecular Weight | 661.74 |
| Formula | C34H47NO12 |
| SMILES | O[C@]12C34[C@@]([C@H]5OC)([H])[C@](CN(CC)C3C5[C@]6(OC(C)=O)[C@@]1([H])[C@@H](OC(C7=CC=CC=C7)=O)[C@@](O)([C@@H](OC)[C@@H]6O)C2)([C@H](O)C[C@@H]4OC)COC |
| Intended Use | For research and further manufacturing use only. |
| Shipping | Room temperature. |
| Catalog Number | Product Name | Order | Quantity |
|---|---|---|---|
| PDP-20264 | Arteannuin L | Inquiry |
|
| PDP-13204 | 7,8-Dihydroxyflavone | Inquiry |
|
| PDP-13459 | Gentiopicroside | Inquiry |
|
| PDP-13324 | Ganoderic Acid A | Inquiry |
|
| PDP-14341 | 4-Hydroxyisoleucine | Inquiry |
|
| PDP-13745 | Purpurogallin | Inquiry |
|
CD BioSustainable is a well-known professional company in the industry. We provide a wide range of bio-environmental products, including bio-based materials, biomass fuels, green building materials, bio-environmental enzymes, bio-environmental microorganisms, etc. Please feel free to explore.
Our products and services are for research use only and cannot be used for any clinical purposes.
