Nalanthalide | CAS No. | 145603-76-5 |
| Molecular Weight | 484.67 |
| Formula | C30H44O5 |
| SMILES | O=C1C(C[C@@H]2C(CC[C@@]3([H])[C@@](CC/C=C(C)/C)(C)[C@@H](OC(C)=O)CC[C@]23C)=C)=C(OC)OC(C)=C1C |
| Intended Use | For research use only. |
| Shipping | Room temperature. |
| Catalog Number | Product Name | Order | Quantity |
|---|---|---|---|
| MDP-22648 | 5-Methyl-2-thiophenecarboxaldehyde (Standard) | Inquiry |
|
| MDP-12340 | 2'-Deoxyuridine (Standard) | Inquiry |
|
| MDP-23271 | Fluostatin B | Inquiry |
|
| MDP-23454 | Alliacol B | Inquiry |
|
| MDP-24116 | Saframycin Mx2 | Inquiry |
|
| MDP-24292 | Phosmidosine B | Inquiry |
|
CD BioSustainable is a well-known professional company in the industry. We provide a wide range of bio-environmental products, including bio-based materials, biomass fuels, green building materials, bio-environmental enzymes, bio-environmental microorganisms, etc. Please feel free to explore.
Our products and services are for research use only and cannot be used for any clinical purposes.
