Napsamycin A | CAS No. | 126049-03-4 |
| Molecular Weight | 852.91 |
| Formula | C39H48N8O12S |
| SMILES | O=C1C=CN(C2O/C(CC2O)=C/NC(C(C(C)N(C)C(C3NCC4=CC=C(C=C4C3)O)=O)NC(C(CCSC)NC(NC(CC5=CC(O)=CC=C5)C(O)=O)=O)=O)=O)C(N1)=O |
| Intended Use | For research use only. |
| Shipping | Room temperature. |
| Catalog Number | Product Name | Order | Quantity |
|---|---|---|---|
| MDP-11158 | Coproporphyrin III | Inquiry |
|
| MDP-24324 | Matlystatin E | Inquiry |
|
| MDP-11154 | Astragalin | Inquiry |
|
| MDP-21922 | Hotrienol | Inquiry |
|
| MDP-23912 | Cinatrin B | Inquiry |
|
| MDP-23561 | 4-O-Demethyl-11-deoxydoxorubicin | Inquiry |
|
CD BioSustainable is a well-known professional company in the industry. We provide a wide range of bio-environmental products, including bio-based materials, biomass fuels, green building materials, bio-environmental enzymes, bio-environmental microorganisms, etc. Please feel free to explore.
Our products and services are for research use only and cannot be used for any clinical purposes.
