Natamycin | CAS No. | 7681-93-8 |
| Purity | 99.07% |
| Synonyms | Pimaricin |
| Molecular Weight | 665.73 |
| Formula | C33H47NO13 |
| Appearance | Solid |
| Color | Off-white to light yellow |
| SMILES | OC([C@H]1[C@@](C[C@H](/C=C/C=C/C=C/C=C/C[C@@H](C)OC2=O)O[C@@](O[C@H](C)[C@@H](O)[C@@H]3N)([H])[C@H]3O)([H])O[C@](O)(C[C@H](C[C@]4([H])[C@@H](/C=C/2)O4)O)C[C@@H]1O)=O |
| Intended Use | For research use only. |
| Shipping | Room temperature |
| Storage |
Powder: -20°C 3 years; 4°C 2 years In solvent: -80°C 6 months; -20°C 1 month |
| Catalog Number | Product Name | Order | Quantity |
|---|---|---|---|
| MDP-23973 | Nebramycin Ⅳ | Inquiry |
|
| MDP-11832 | Fusicoccin | Inquiry |
|
| MDP-23438 | Isariin A | Inquiry |
|
| MDP-11722 | 2,5-Dihydroxybenzaldehyde | Inquiry |
|
| MDP-24294 | Pentenocin B | Inquiry |
|
| MDP-23249 | 2-Naphthol (Standard) | Inquiry |
|
CD BioSustainable is a well-known professional company in the industry. We provide a wide range of bio-environmental products, including bio-based materials, biomass fuels, green building materials, bio-environmental enzymes, bio-environmental microorganisms, etc. Please feel free to explore.
Our products and services are for research use only and cannot be used for any clinical purposes.
