Neoline | Synonyms | Bullatine B |
| Appearance | Solid |
| CAS | 466-26-2 |
| Purity | ≥98.0% |
| Molecular Weight | 437.57 |
| Formula | C24H39NO6 |
| Color | White to off-white |
| SMILES | O[C@@H]1C23[C@@]4([H])[C@](COC)(CN(CC)C2C([C@]5(O)[C@]6([H])[C@@]3([H])C[C@@]([C@@H](OC)C5)([H])[C@@H]6O)[C@@H]4OC)CC1 |
| Intended Use | For research and further manufacturing use only. |
| Storage |
4°C, protect from light In solvent: -80°C, 6 months; -20°C, 1 month (protect from light) |
| Shipping | Room temperature. |
| Catalog Number | Product Name | Order | Quantity |
|---|---|---|---|
| PDP-19388 | Rubianthraquinone | Inquiry |
|
| PDP-13108 | Camptothecin | Inquiry |
|
| PDP-19115 | Corymbiferin | Inquiry |
|
| PDP-13754 | Bergaptol | Inquiry |
|
| PDP-16136 | Ilexoside D | Inquiry |
|
| PDP-17918 | Rubelloside B | Inquiry |
|
CD BioSustainable is a well-known professional company in the industry. We provide a wide range of bio-environmental products, including bio-based materials, biomass fuels, green building materials, bio-environmental enzymes, bio-environmental microorganisms, etc. Please feel free to explore.
Our products and services are for research use only and cannot be used for any clinical purposes.
