Neomangiferin | Appearance | Solid |
| CAS | 64809-67-2 |
| Purity | 99.80% |
| Molecular Weight | 584.48 |
| Formula | C25H28O16 |
| Color | White to light yellow |
| SMILES | OC1=C(C2=O)C(OC3=CC(O)=C(O[C@@H]([C@@H]([C@@H](O)[C@@H]4O)O)O[C@@H]4CO)C=C23)=CC(O)=C1[C@@H]([C@@H]([C@@H](O)[C@@H]5O)O)O[C@@H]5CO |
| Intended Use | For research and further manufacturing use only. |
| Storage |
4°C, protect from light In solvent: -80°C, 6 months; -20°C, 1 month (protect from light) |
| Shipping | Room temperature. |
| Catalog Number | Product Name | Order | Quantity |
|---|---|---|---|
| PDP-20121 | Ricinine (Standard) | Inquiry |
|
| PDP-20466 | Herbacetin (Standard) | Inquiry |
|
| PDP-17439 | Justin C | Inquiry |
|
| PDP-16319 | 23-Hydroxylongispinogenin | Inquiry |
|
| PDP-14848 | Orcinol Gentiobioside | Inquiry |
|
| PDP-16050 | Sibiricaxanthone B | Inquiry |
|
CD BioSustainable is a well-known professional company in the industry. We provide a wide range of bio-environmental products, including bio-based materials, biomass fuels, green building materials, bio-environmental enzymes, bio-environmental microorganisms, etc. Please feel free to explore.
Our products and services are for research use only and cannot be used for any clinical purposes.
