Neoprocurcumenol | CAS | 102130-91-6 |
| Molecular Weight | 234.33 |
| Formula | C15H22O2 |
| SMILES | C[C@]1([C@](C/C2=C(C)\C)([H])C(CC1)=C(CC2=O)C)O |
| Intended Use | For research and further manufacturing use only. |
| Shipping | Room temperature. |
| Catalog Number | Product Name | Order | Quantity |
|---|---|---|---|
| PDP-17832 | Eschweilenol C | Inquiry |
|
| PDP-17272 | Alismanol M | Inquiry |
|
| PDP-19433 | Preschisanartanin B | Inquiry |
|
| PDP-19940 | Iridin (Standard) | Inquiry |
|
| PDP-13360 | Esculetin | Inquiry |
|
| PDP-15059 | 9,10-Dihydroxystearic Acid | Inquiry |
|
CD BioSustainable is a well-known professional company in the industry. We provide a wide range of bio-environmental products, including bio-based materials, biomass fuels, green building materials, bio-environmental enzymes, bio-environmental microorganisms, etc. Please feel free to explore.
Our products and services are for research use only and cannot be used for any clinical purposes.
