Neorauflavane | Appearance | Solid |
| CAS | 53734-74-0 |
| Molecular Weight | 354.40 |
| Formula | C21H22O5 |
| Color | White to off-white |
| SMILES | COC1=C2C(OC[C@@H](C3=C(C=C(O)C=C3)O)C2)=CC4=C1C=CC(C)(C)O4 |
| Intended Use | For research and further manufacturing use only. |
| Storage |
Powder: -20°C 3 years In solvent: -80°C 6 months; -20°C 1 month |
| Shipping | Room temperature. |
| Catalog Number | Product Name | Order | Quantity |
|---|---|---|---|
| PDP-15567 | Tenuifoliside C | Inquiry |
|
| PDP-17531 | 9-O-Methylstecepharine | Inquiry |
|
| PDP-16778 | Brachyoside B | Inquiry |
|
| PDP-13346 | Embelin | Inquiry |
|
| PDP-17727 | Yunnankadsurin B | Inquiry |
|
| PDP-19004 | 20-Gluco-ginsenoside-Rf | Inquiry |
|
CD BioSustainable is a well-known professional company in the industry. We provide a wide range of bio-environmental products, including bio-based materials, biomass fuels, green building materials, bio-environmental enzymes, bio-environmental microorganisms, etc. Please feel free to explore.
Our products and services are for research use only and cannot be used for any clinical purposes.
