Neotheaflavin | Appearance | Solid |
| CAS | 36451-14-6 |
| Purity | 99.61% |
| Molecular Weight | 564.49 |
| Formula | C29H24O12 |
| Color | Pink to red |
| SMILES | OC1=C(C2=O)C(C=C([C@H]3OC4=CC(O)=CC(O)=C4C[C@H]3O)C=C2O)=C([C@H]5OC6=CC(O)=CC(O)=C6C[C@@H]5O)C=C1O |
| Intended Use | For research and further manufacturing use only. |
| Storage |
-20°C, protect from light In solvent: -80°C, 6 months; -20°C, 1 month (protect from light) |
| Shipping | Room temperature. |
| Catalog Number | Product Name | Order | Quantity |
|---|---|---|---|
| PDP-13303 | Ginkgolide B | Inquiry |
|
| PDP-17538 | Mbamiloside A | Inquiry |
|
| PDP-13321 | Forsythoside B | Inquiry |
|
| PDP-20041 | (±)-Alliin (Standard) | Inquiry |
|
| PDP-18995 | 2-Hydroxymethyl-3-hydroxyanthraquinone | Inquiry |
|
| PDP-14434 | Arteannuin B | Inquiry |
|
CD BioSustainable is a well-known professional company in the industry. We provide a wide range of bio-environmental products, including bio-based materials, biomass fuels, green building materials, bio-environmental enzymes, bio-environmental microorganisms, etc. Please feel free to explore.
Our products and services are for research use only and cannot be used for any clinical purposes.
