Nepetoidin B | CAS | 55486-06-1 |
| Molecular Weight | 314.29 |
| Formula | C17H14O6 |
| SMILES | O=C(O/C=C\C1=CC=C(O)C(O)=C1)/C=C/C2=CC=C(O)C(O)=C2 |
| Intended Use | For research and further manufacturing use only. |
| Shipping | Room temperature. |
| Catalog Number | Product Name | Order | Quantity |
|---|---|---|---|
| PDP-17330 | 5-Hydroxyseselin | Inquiry |
|
| PDP-20457 | Peiminine (Standard) | Inquiry |
|
| PDP-17549 | Apigenin-6-C-β-D-xylopyranosyl-8-C-α-L-arabinopyranoside | Inquiry |
|
| PDP-19927 | Taraxerol (Standard) | Inquiry |
|
| PDP-15595 | Gomisin M2 | Inquiry |
|
| PDP-14590 | Cirsimaritin | Inquiry |
|
CD BioSustainable is a well-known professional company in the industry. We provide a wide range of bio-environmental products, including bio-based materials, biomass fuels, green building materials, bio-environmental enzymes, bio-environmental microorganisms, etc. Please feel free to explore.
Our products and services are for research use only and cannot be used for any clinical purposes.
