Norpterosin C | CAS | 64890-70-6 |
| Molecular Weight | 220.26 |
| Formula | C13H16O3 |
| SMILES | O[C@@H]1C2=CC(C)=C(CO)C(C)=C2C([C@H]1C)=O |
| Intended Use | For research and further manufacturing use only. |
| Shipping | Room temperature. |
| Catalog Number | Product Name | Order | Quantity |
|---|---|---|---|
| PDP-13980 | Diosgenin Glucoside | Inquiry |
|
| PDP-19126 | Wilforlide B | Inquiry |
|
| PDP-15456 | (R)-(+)-O-Demethylbuchenavianine | Inquiry |
|
| PDP-13937 | Meisoindigo | Inquiry |
|
| PDP-17147 | 1,4,5,6-Tetrahydroxy-7-(3-methylbut-2-enyl)xanthone | Inquiry |
|
| PDP-15009 | Tirucallol | Inquiry |
|
CD BioSustainable is a well-known professional company in the industry. We provide a wide range of bio-environmental products, including bio-based materials, biomass fuels, green building materials, bio-environmental enzymes, bio-environmental microorganisms, etc. Please feel free to explore.
Our products and services are for research use only and cannot be used for any clinical purposes.
