Notoginsenoside Fe | Synonyms | Notoginseng Triterpenes; Ginsenoside Mb |
| Appearance | Solid |
| CAS | 88105-29-7 |
| Purity | 99.94% |
| Molecular Weight | 917.13 |
| Formula | C47H80O17 |
| Color | Light yellow to yellow |
| SMILES | C[C@]12[C@@](C)([C@]3([H])C[C@@H](O)[C@]1([H])[C@@]([H])([C@](C)(CC/C=C(C)/C)O[C@@H]4O[C@H](CO[C@@H]5O[C@@H](CO)[C@H](O)[C@H]5O)[C@@H](O)[C@H](O)[C@H]4O)CC2)CC[C@@]([C@]3(C)CC6)([H])C(C)(C)[C@H]6O[C@@]7([H])[C@H](O)[C@@H](O)[C@H](O)[C@@H](CO)O7 |
| Intended Use | For research and further manufacturing use only. |
| Storage |
Powder: -20°C 3 years; 4°C 2 years In solvent: -80°C 6 months; -20°C 1 month |
| Shipping | Room temperature. |
| Catalog Number | Product Name | Order | Quantity |
|---|---|---|---|
| PDP-18692 | 3-O-Methylellagic Acid | Inquiry |
|
| PDP-17186 | (-)-11,13-Dehydroeriolin | Inquiry |
|
| PDP-19446 | (E)-4-(3,4-Dimethoxyphenyl)but-3-ene-1,2-diol | Inquiry |
|
| PDP-16483 | (E)-Ajoene | Inquiry |
|
| PDP-14042 | Calceolarioside B | Inquiry |
|
| PDP-20252 | Kmeriol | Inquiry |
|
CD BioSustainable is a well-known professional company in the industry. We provide a wide range of bio-environmental products, including bio-based materials, biomass fuels, green building materials, bio-environmental enzymes, bio-environmental microorganisms, etc. Please feel free to explore.
Our products and services are for research use only and cannot be used for any clinical purposes.
