Nybomycin | CAS No. | 30408-30-1 |
| Purity | ≥99.0% |
| Molecular Weight | 298.29 |
| Formula | C16H14N2O4 |
| Appearance | Solid |
| Color | Off-white to light brown |
| SMILES | O=C1N2C3=C(C4=C(C=C3C(C)=C1)C(CO)=CC(N4C)=O)OC2 |
| Intended Use | For research use only. |
| Shipping | Room temperature |
| Storage |
-20°C, sealed storage, away from moisture In solvent: -80°C, 6 months; -20°C, 1 month (sealed storage, away from moisture) |
| Catalog Number | Product Name | Order | Quantity |
|---|---|---|---|
| MDP-22290 | Astragalin (Standard) | Inquiry |
|
| MDP-11190 | β-Cyclodextrin | Inquiry |
|
| MDP-24254 | Cedarmycin A | Inquiry |
|
| MDP-23161 | Cyclo(L-Leu-trans-4-hydroxy-L-Pro) | Inquiry |
|
| MDP-22116 | Shermilamine B | Inquiry |
|
| MDP-12732 | Clavirolide L | Inquiry |
|
CD BioSustainable is a well-known professional company in the industry. We provide a wide range of bio-environmental products, including bio-based materials, biomass fuels, green building materials, bio-environmental enzymes, bio-environmental microorganisms, etc. Please feel free to explore.
Our products and services are for research use only and cannot be used for any clinical purposes.
