Odoratisol A | CAS | 891182-93-7 |
| Molecular Weight | 356.41 |
| Formula | C21H24O5 |
| SMILES | COC1=C2C([C@@H]([C@](C3=CC(OC)=C(C(OC)=C3)O)([H])O2)C)=CC(/C=C/C)=C1 |
| Intended Use | For research and further manufacturing use only. |
| Shipping | Room temperature. |
| Catalog Number | Product Name | Order | Quantity |
|---|---|---|---|
| PDP-13807 | L-Hyoscyamine | Inquiry |
|
| PDP-18126 | Odonicin | Inquiry |
|
| PDP-16688 | 5-Hydroxy-3,6,7,4'-tetramethoxyflavone | Inquiry |
|
| PDP-18570 | Cowaxanthone B | Inquiry |
|
| PDP-18884 | Bakkenolide IIIa | Inquiry |
|
| PDP-18197 | Lycoclavanol | Inquiry |
|
CD BioSustainable is a well-known professional company in the industry. We provide a wide range of bio-environmental products, including bio-based materials, biomass fuels, green building materials, bio-environmental enzymes, bio-environmental microorganisms, etc. Please feel free to explore.
Our products and services are for research use only and cannot be used for any clinical purposes.
