Odorine | Synonyms | Roxburghiline |
| CAS | 72755-20-5 |
| Molecular Weight | 300.40 |
| Formula | C18H24N2O2 |
| SMILES | CC[C@H](C)C(N[C@@H]1N(CCC1)C(/C=C/C2=CC=CC=C2)=O)=O |
| Intended Use | For research and further manufacturing use only. |
| Shipping | Room temperature. |
| Catalog Number | Product Name | Order | Quantity |
|---|---|---|---|
| PDP-17162 | 10-Hydroxydihydroperaksine | Inquiry |
|
| PDP-15688 | Jionoside B1 | Inquiry |
|
| PDP-20561 | Protodioscin (Standard) | Inquiry |
|
| PDP-19731 | Cyasterone (Standard) | Inquiry |
|
| PDP-14930 | Vanillin (Standard) | Inquiry |
|
| PDP-15937 | Demethoxycapillarisin | Inquiry |
|
CD BioSustainable is a well-known professional company in the industry. We provide a wide range of bio-environmental products, including bio-based materials, biomass fuels, green building materials, bio-environmental enzymes, bio-environmental microorganisms, etc. Please feel free to explore.
Our products and services are for research use only and cannot be used for any clinical purposes.
