Oligomycin B | CAS No. | 11050-94-5 |
| Molecular Weight | 805.05 |
| Formula | C45H72O12 |
| Appearance | Solid |
| Color | White to off-white |
| SMILES | O=C([C@@H]([C@H]([C@@H](C([C@@](C)([C@H]([C@@H](C/C=C/C=C/[C@@]([H])(CC[C@]1([C@H]([C@@]([H])(O2)[C@@H]([C@]3(O1)C(C[C@@H]([C@@]([H])(O3)C[C@@H](C)O)C)=O)C)C)[H])CC)C)O)O)=O)C)O)C)[C@H]([C@@H]([C@H](/C=C/C2=O)C)O)C |
| Intended Use | For research use only. |
| Shipping | Room temperature |
| Storage |
-20°C, protect from light, stored under nitrogen In solvent: -80°C, 6 months; -20°C, 1 month (protect from light, stored under nitrogen) |
| Catalog Number | Product Name | Order | Quantity |
|---|---|---|---|
| MDP-22018 | Maydispenoid B | Inquiry |
|
| MDP-11389 | Thiolutin | Inquiry |
|
| MDP-24219 | 11-Deoxy-13-dihydrodaunorubicin | Inquiry |
|
| MDP-23590 | Clavamycin E | Inquiry |
|
| MDP-22324 | (E)-β-Ionone (Standard) | Inquiry |
|
| MDP-11086 | Citric Acid | Inquiry |
|
CD BioSustainable is a well-known professional company in the industry. We provide a wide range of bio-environmental products, including bio-based materials, biomass fuels, green building materials, bio-environmental enzymes, bio-environmental microorganisms, etc. Please feel free to explore.
Our products and services are for research use only and cannot be used for any clinical purposes.
