Ophioglonol | CAS | 850894-19-8 |
| Molecular Weight | 316.26 |
| Formula | C16H12O7 |
| SMILES | O=C1C2=C(OC(C3=CC(O)=C(O)C=C3)=C1CO)C=C(O)C=C2O |
| Intended Use | For research and further manufacturing use only. |
| Shipping | Room temperature. |
| Catalog Number | Product Name | Order | Quantity |
|---|---|---|---|
| PDP-18765 | 7-Xylosyl-10-Deacetyltaxol B | Inquiry |
|
| PDP-15269 | Polyporenic Acid C | Inquiry |
|
| PDP-16610 | Octahydroisoindole | Inquiry |
|
| PDP-19971 | (+)-Peusedanol (Standard) | Inquiry |
|
| PDP-18066 | Aporeine | Inquiry |
|
| PDP-20139 | Peimisine (Standard) | Inquiry |
|
CD BioSustainable is a well-known professional company in the industry. We provide a wide range of bio-environmental products, including bio-based materials, biomass fuels, green building materials, bio-environmental enzymes, bio-environmental microorganisms, etc. Please feel free to explore.
Our products and services are for research use only and cannot be used for any clinical purposes.
