Oroxin B (Standard) | CAS | 114482-86-9 |
| Molecular Weight | 594.52 |
| Formula | C27H30O15 |
| SMILES | O=C1C=C(C2=CC=CC=C2)OC3=CC(O[C@H]4[C@@H]([C@H]([C@@H]([C@@H](CO[C@H]5[C@@H]([C@H]([C@@H]([C@@H](CO)O5)O)O)O)O4)O)O)O)=C(O)C(O)=C13 |
| Intended Use | For research and further manufacturing use only. |
| Catalog Number | Product Name | Order | Quantity |
|---|---|---|---|
| PDP-18946 | Trijuganone C | Inquiry |
|
| PDP-13671 | Picrotoxinin | Inquiry |
|
| PDP-18898 | Vitexolide D | Inquiry |
|
| PDP-18921 | 3-Acetylpinobanksin-7-methyl Ether | Inquiry |
|
| PDP-20141 | Toosendanin (Standard) | Inquiry |
|
| PDP-16577 | Sinensin | Inquiry |
|
CD BioSustainable is a well-known professional company in the industry. We provide a wide range of bio-environmental products, including bio-based materials, biomass fuels, green building materials, bio-environmental enzymes, bio-environmental microorganisms, etc. Please feel free to explore.
Our products and services are for research use only and cannot be used for any clinical purposes.
