OSW-1 | Appearance | Solid |
| CAS | 145075-81-6 |
| Purity | 99.66% |
| Molecular Weight | 873.03 |
| Formula | C47H68O15 |
| Color | White to off-white |
| SMILES | C[C@@]1([C@@]2(O)[C@H](C)C(CCC(C)C)=O)[C@](C[C@@H]2O[C@@](OC[C@H](O)[C@@H]3O[C@@](OC[C@@H](O)[C@@H]4O)([H])[C@@H]4OC(C5=CC=C(OC)C=C5)=O)([H])[C@@H]3OC(C)=O)([H])[C@@](CC=C6[C@@]7(CC[C@H](O)C6)C)([H])[C@]7([H])CC1 |
| Intended Use | For research and further manufacturing use only. |
| Storage |
-20°C, protect from light, stored under nitrogen In solvent: -80°C, 6 months; -20°C, 1 month (protect from light, stored under nitrogen) |
| Shipping | Room temperature. |
| Catalog Number | Product Name | Order | Quantity |
|---|---|---|---|
| PDP-16726 | Methyllucidone | Inquiry |
|
| PDP-15341 | Crassicauline A | Inquiry |
|
| PDP-19671 | Cephaeline Dihydrochloride (Standard) | Inquiry |
|
| PDP-13405 | Schisandrin B | Inquiry |
|
| PDP-13026 | Elderberry Fruit Extract | Inquiry |
|
| PDP-16351 | 9-Oxononanoic Acid | Inquiry |
|
CD BioSustainable is a well-known professional company in the industry. We provide a wide range of bio-environmental products, including bio-based materials, biomass fuels, green building materials, bio-environmental enzymes, bio-environmental microorganisms, etc. Please feel free to explore.
Our products and services are for research use only and cannot be used for any clinical purposes.