Otophylloside B | Appearance | Solid |
| CAS | 106758-54-7 |
| Purity | 99.26% |
| Molecular Weight | 923.13 |
| Formula | C49H78O16 |
| Color | White to off-white |
| SMILES | O[C@]([C@@]([C@]1([H])C2)(CC=C3[C@@]1(CC[C@H](O[C@@](O[C@H](C)[C@H]4O[C@@](O[C@H](C)[C@H]5O[C@@](O[C@H](C)[C@H]6O)([H])C[C@H]6OC)([H])C[C@@H]5OC)([H])C[C@@H]4OC)C3)C)O)(CC[C@@]7(O)C(C)=O)[C@@]7([C@@H]2OC(/C=C(C)/C(C)C)=O)C |
| Intended Use | For research and further manufacturing use only. |
| Storage |
-20°C, protect from light In solvent: -80°C, 6 months; -20°C, 1 month (protect from light) |
| Shipping | Room temperature. |
| Catalog Number | Product Name | Order | Quantity |
|---|---|---|---|
| PDP-20534 | Ginsenoside Rg2 (Standard) | Inquiry |
|
| PDP-17878 | Marsglobiferin | Inquiry |
|
| PDP-18102 | Pinusolide | Inquiry |
|
| PDP-19837 | (-)-Anomalin (Standard) | Inquiry |
|
| PDP-18051 | 7-O-Isopentenyl-γ-fagarine | Inquiry |
|
| PDP-14147 | Xylotetraose | Inquiry |
|
CD BioSustainable is a well-known professional company in the industry. We provide a wide range of bio-environmental products, including bio-based materials, biomass fuels, green building materials, bio-environmental enzymes, bio-environmental microorganisms, etc. Please feel free to explore.
Our products and services are for research use only and cannot be used for any clinical purposes.
